Urgent !!!!!!!!!! Due today plzzzzz help me

Urgent !!!!!!!!!! Due Today Plzzzzz Help Me

Answers

Answer 1

Answer:

Explanation:

a. H3O+

b.  H3O+

c. CH3C(OH2)+


Related Questions

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

An unbalanced chemical equation is shown:

2NaN3 → 2Na + N2

Which of the following statements explains why the equation is not balanced?

Four molecules of N2 should be produced during the decomposition.
Three molecules of N2 should be produced during the decomposition.
Four molecules of N2 should be produced during the synthesis reaction.
Three molecules of N2 should be produced during the synthesis reaction.

Answers

The correct statement is B. Three molecules of N₂ should be produced during the decomposition. :)

Answer: b

Explanation: I took the quiz

Calculate the gravitational force between two objects when they are 0.75m apart each object has a mass of 5.00kg

Answers

Answer:

0.000000000666863

Explanation:

F = GMm/R²

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Which container has gas stored at the highest temperature

Answers

Answer: 3

Explanation:

Answer:

kinetic energy

Explanation:

may be iam not sure

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

Use the equation below to solve the problem that follows.

2H2 (g) + O2 (g) → 2H2O (g)

When David reacts 13.8 grams of hydrogen gas with excess oxygen, 87.0 grams of water are formed. Calculate his percent yield of water.

Answers

Percent yield = 70%

Further eplanation

Percent yield is the comparison of the amount of product obtained from a reaction with the amount you calculated

General formula:

Percent yield = (Actual yield / theoretical yield )x 100%

An actual yield is the amount of product actually produced by the reaction. A theoretical yield is the amount of product that you calculate from the reaction equation according to the product and reactant coefficients

Reaction

2H₂ (g) + O₂ (g) → 2H₂O (g)

mass of H₂O (theoretical) :

[tex]\tt mass=mol\times MW(mol~ratio~H_2O\div H_2=2\div 2)\\\\mass=(\dfrac{2}{2}\times \dfrac{13.8}{2})\times 18~g/mol\\\\mass=124.2~g[/tex]

percent yield

[tex]\tt \%yield=\dfrac{87}{124.2}\times 100\%=\boxed{\bold{70\%}}[/tex]

Arrange the elements in order of increasing ionization energy. Use the
periodic table to identify their positions on the table.
Drag each tile to the correct box.
Hola
Tiles
chlorine
fluorine
gallium
phosphorus
Sequence

Answers

Answer:

Gallium - Phosphorous - Fluorine - Chlorine

Explanation:

Answer:

Gallium < Phosphorus < Chlorine < Fluorine

Explanation:

<3

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

Why is our mindset more important when you try to learn remotely than when you are learning face to face?

Answers

Answer:

It is more important because of the freedom.

Explanation:

While at home you can do your work of course... but you could lay down, take a nap. You could get on the game, play around. You could draw, and fiddle and dance and do WHATEVER you want with no teacher to stop you so you have to be your own motivation. You have to be your own teacher or its VERY easy to fail.

The diagram is a model of one way that materials move into a cell.


Which Sentence explains what happens in last step?

A. a vacuole carries particles into the cell
B. The cell membrane surrounds particles outside the cell.
C. Phospholipids in the cell membrane allow particles to pass through
D. Transport proteins push particles out of cell.

Answers

Answer:

B. The cell membrane surrounds particles outside the cell.

Explanation:

The last step is when the cell membrane completely surrounds particles outside the cell.

This process is often known as endocytosis.

endocytosis is the process whereby a cell ingests materials by engulfing them using the cell membrane. In this process, the cell membrane completely covers the food.

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

What is the mass of one electron in grams if an electron has the charge of
-1.6022 x 10-19C and lg = -1.76 x 108 C.

Answers

The mass of one electron : 9.103 x 10⁻²⁸ g

Further explanation

Electrons are a part of the atomic nucleus particles (including protons and neutrons), and are negatively charged (-1)

An electron has the charge of  -1.6022 x 10⁻¹⁹C

1 g =  -1.76 x 10⁸ C

so the mass of one electron :

[tex]\tt \dfrac{1.6022\times 10^{-19}}{1.76\times 10^8}=9.103\times 10^{-28}~g[/tex]

Other Questions
Why is it so important for teens, and even younger children, to have regular responsibilities within the family? A. It gives kids a way to earn money for doing chores. B. It helps children and teens develop into responsible adults. C. It keeps them busy so they will not have time to be mischievous. D. It keeps things equal and fair for everyone in the family. Passes through (-6,-1) and is parallel to y=-2/3x+1 Which event happens first?Read the paragraph."Where'd you find this pot roast, Ms. H.? In the gutter?!"Dead silence. Amanda stared at me with her mouthopen. Ms. Howard frowned.I had been sitting at the Howards' dinner table, trying tothink of something funny to say. I wanted to fit in withmy friend's family so badly. They were all hilarious,cracking jokes throughout dinner.Suddenly, it had hit me. I'd use my favorite comedian'sbest tag line: "In the gutter?!" I thought it would be ahuge hit! Boy, was I wrong.O Amanda's friend insults Ms. Howard's cooking.O Amanda stares at the friend with her mouth open.O Amanda's friend and her family are eating dinner.Amanda's friend thinks her friend will use acomedian's tag line rob bought 15 concert tickets worth $322.50. Floor tickets cost $25 each while balcony tickets cost $17.50 each. How many tickets of each type did rob bye? For the number line shown which statement is not true I NEED HELP ASAP PLS HELP ME IF YOU KNOW HOW TO DO THIS!!!!!!!!!!!!!!!!!!!!!!!!!! Drag each tile to the correct location.Match each term to the appropriate definition.disproves or refutes, a stated claiman arguable statement made to takea stance or show positionsupport such as facts, statistics, oranecdotes to support a claimcounterclaimclaimevidence Which statements best describes the difference between interest and debt Please hurry1. Identify one environmental factor that could cause a base sequence in DNA to be changed to a different base sequence.2. Explain why, in a mammal, a mutation in a gamete may contribute to change in the population of the organism while a mutation a body cell will not. Read the passage.I was leaning against the high stone wall that ran around the schoolyard. Iwas looking up at a white cloud skittering across the sky when all at oncesomeone tramped down hard on my right foot. Ian Forbes. Snarling bulldogface. Heel grinding down on my toes. Head thrust forward the way ananimal might before it strikes."You wouldn't sing it. So say it," he ordered. "Let me hear you say it."I tried to pull my foot away but he only ground down harder."Say what?" I was telling my face please not to show what my foot felt."God save the king. Say it. Those four words. I want to hear you say it.""I'll never say it." I whispered.What does this schoolyard encounter repeal about both characters?Neither feels at home in China.They miss their homeland.They are deeply patriotic.lan is a bully who frightens Jean. What category of the factors of production would an Inventor fall intoQuestion 4 options:LandCaptialLaborEntrepreneurship PLEASE ANSWER THIS (DUE TMR) Which phrases in the excerpt does the author use to show that Schweizer is talented and destined to do well Henri earned a salary of $50,000 in 2001 and $70,000 in 2006. The consumer price index was 177 in 2001 and 265.5 in 2006. Henri's 2006 salary in 2001 dollars is:_______.a. $105,000.00. b. $46,666.67. c. $35,000.00. d. $61,950.00 Consider the line y = 2x4.What is the slope of a line parallel to this line?What is the slope of a line perpendicular to this line? "Some people call him a koala "bear," but he is not a bear."This sentence is an example of a(n) _____.introductory sentencesupport sentencequotationtopic sentencesummary sentencetransitional device True or False: GLOBAL WINDS"sea and land breezes over a large region (india) that change directions are called global winds."true or false?"Winds that blow steadily from specific direction over long distances are called doldrums."true or false?"The way earths rotation makes winds curve is called the prevailing westerlies."true or false?"bands of high speed winds about 10 kilometers above earths surface are called polar easterlies."true or false? Are Bacteria (essential/non-essential) to sustaining the EcoSphere? Different plant species require different amounts of direct sunlight in order to flower. A student designed an experiment to determine the length of exposure to direct sunlight necessary for a specific plant species to produce flowers. The student collected the data below.0 hours, 0% with flowers9 hours, 0% with flowers1 hour, 0% with flowers5 hours, 90% with flowers3 hours, 80% with flowers7 hours, 10% with flowersIdentify the:independent variable- dependent variable-control group-experimental group-constant- 13 List five examples of functionality that can be added when using expresscards?